C18H10F3NO4S2 — CID 87307096
2-hydroxy-5-[(E)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]benzoic acid (PubChem CID 87307096) has the molecular formula C18H10F3NO4S2 and a molecular weight of 425.41 g/mol. Its IUPAC name is 2-hydroxy-5-[(E)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]benzoic acid.
| Compound Name | 2-hydroxy-5-[(E)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 87307096 |
| Molecular Formula | C18H10F3NO4S2 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 2-hydroxy-5-[(E)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
| SMILES | O=C(O)c1cc(/C=C2/SC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)ccc1O |
| InChI | InChI=1S/C18H10F3NO4S2/c19-18(20,21)10-2-1-3-11(8-10)22-15(24)14(28-17(22)27)7-9-4-5-13(23)12(6-9)16(25)26/h1-8,23H,(H,25,26)/b14-7+ |
| InChIKey | NAHHGABJJJVZNP-VGOFMYFVSA-N |
| XLogP | 4.51 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|