C19H13NO6S2 — CID 6225665
5-[(5Z)-5-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-hydroxybenzoic acid (PubChem CID 6225665) has the molecular formula C19H13NO6S2 and a molecular weight of 415.45 g/mol. Its IUPAC name is 5-[(5Z)-5-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-hydroxybenzoic acid.
| Compound Name | 5-[(5Z)-5-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 6225665 |
| Molecular Formula | C19H13NO6S2 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 5-[(5Z)-5-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(N2C(=O)/C(=C/c3ccc4c(c3)OCCO4)SC2=S)ccc1O |
| InChI | InChI=1S/C19H13NO6S2/c21-13-3-2-11(9-12(13)18(23)24)20-17(22)16(28-19(20)27)8-10-1-4-14-15(7-10)26-6-5-25-14/h1-4,7-9,21H,5-6H2,(H,23,24)/b16-8- |
| InChIKey | OAZVDTOIMLRSDO-PXNMLYILSA-N |
| XLogP | 3.27 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|