C21H13NO4S2 — CID 27431941
2-hydroxy-5-[(5Z)-5-(naphthalen-1-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid (PubChem CID 27431941) has the molecular formula C21H13NO4S2 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-hydroxy-5-[(5Z)-5-(naphthalen-1-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid.
| Compound Name | 2-hydroxy-5-[(5Z)-5-(naphthalen-1-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 27431941 |
| Molecular Formula | C21H13NO4S2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 2-hydroxy-5-[(5Z)-5-(naphthalen-1-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cc(N2C(=O)/C(=C/c3cccc4ccccc34)SC2=S)ccc1O |
| InChI | InChI=1S/C21H13NO4S2/c23-17-9-8-14(11-16(17)20(25)26)22-19(24)18(28-21(22)27)10-13-6-3-5-12-4-1-2-7-15(12)13/h1-11,23H,(H,25,26)/b18-10- |
| InChIKey | FASCDBYATFJNCM-ZDLGFXPLSA-N |
| XLogP | 4.65 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|