C20H12N2O4S2 — CID 50739693
2-hydroxy-4-[(5Z)-4-oxo-5-(quinolin-8-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid (PubChem CID 50739693) has the molecular formula C20H12N2O4S2 and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-hydroxy-4-[(5Z)-4-oxo-5-(quinolin-8-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid.
| Compound Name | 2-hydroxy-4-[(5Z)-4-oxo-5-(quinolin-8-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 50739693 |
| Molecular Formula | C20H12N2O4S2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 2-hydroxy-4-[(5Z)-4-oxo-5-(quinolin-8-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)/C(=C/c3cccc4cccnc34)SC2=S)cc1O |
| InChI | InChI=1S/C20H12N2O4S2/c23-15-10-13(6-7-14(15)19(25)26)22-18(24)16(28-20(22)27)9-12-4-1-3-11-5-2-8-21-17(11)12/h1-10,23H,(H,25,26)/b16-9- |
| InChIKey | GJFJNALVOLINAD-SXGWCWSVSA-N |
| XLogP | 4.04 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|