C20H12N2O3S2 — CID 71965474
3-(1,3-benzodioxol-5-yl)-5-(quinolin-8-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 71965474) has the molecular formula C20H12N2O3S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-(quinolin-8-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-(quinolin-8-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 71965474 |
| Molecular Formula | C20H12N2O3S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-(quinolin-8-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2cccc3cccnc23)SC(=S)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H12N2O3S2/c23-19-17(9-13-4-1-3-12-5-2-8-21-18(12)13)27-20(26)22(19)14-6-7-15-16(10-14)25-11-24-15/h1-10H,11H2 |
| InChIKey | FEKJKNKTCGBXKK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|