C20H15NO6S2 — CID 27417974
3-[2-[(E)-[3-(1,3-benzodioxol-5-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid (PubChem CID 27417974) has the molecular formula C20H15NO6S2 and a molecular weight of 429.48 g/mol. Its IUPAC name is 3-[2-[(E)-[3-(1,3-benzodioxol-5-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid.
| Compound Name | 3-[2-[(E)-[3-(1,3-benzodioxol-5-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 27417974 |
| Molecular Formula | C20H15NO6S2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 3-[2-[(E)-[3-(1,3-benzodioxol-5-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid |
| SMILES | O=C(O)CCOc1ccccc1/C=C1/SC(=S)N(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C20H15NO6S2/c22-18(23)7-8-25-14-4-2-1-3-12(14)9-17-19(24)21(20(28)29-17)13-5-6-15-16(10-13)27-11-26-15/h1-6,9-10H,7-8,11H2,(H,22,23)/b17-9+ |
| InChIKey | SZRMFWCKXYPNMK-RQZCQDPDSA-N |
| XLogP | 3.67 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|