C16H10N2O3S2 — CID 3896916
3-(1,3-benzodioxol-5-yl)-5-(pyridin-4-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3896916) has the molecular formula C16H10N2O3S2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-(pyridin-4-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-(pyridin-4-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3896916 |
| Molecular Formula | C16H10N2O3S2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-(pyridin-4-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2ccncc2)SC(=S)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H10N2O3S2/c19-15-14(7-10-3-5-17-6-4-10)23-16(22)18(15)11-1-2-12-13(8-11)21-9-20-12/h1-8H,9H2 |
| InChIKey | XETGANRTMYKHKP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|