C18H10F3NO3S2 — CID 1354707
5-(1,3-benzodioxol-5-ylmethylidene)-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one (PubChem CID 1354707) has the molecular formula C18H10F3NO3S2 and a molecular weight of 409.41 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylidene)-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylidene)-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1354707 |
| Molecular Formula | C18H10F3NO3S2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylidene)-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2ccc3c(c2)OCO3)SC(=S)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H10F3NO3S2/c19-18(20,21)11-2-1-3-12(8-11)22-16(23)15(27-17(22)26)7-10-4-5-13-14(6-10)25-9-24-13/h1-8H,9H2 |
| InChIKey | CEWYVMSQSILEPR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|