C20H9Cl2NO5S2 — CID 126380366
(5Z)-3-(1,3-benzodioxol-5-yl)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126380366) has the molecular formula C20H9Cl2NO5S2 and a molecular weight of 478.33 g/mol. Its IUPAC name is (5Z)-3-(1,3-benzodioxol-5-yl)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(1,3-benzodioxol-5-yl)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126380366 |
| Molecular Formula | C20H9Cl2NO5S2 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 476.93 |
| IUPAC Name | (5Z)-3-(1,3-benzodioxol-5-yl)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2coc3c(Cl)cc(Cl)cc3c2=O)SC(=S)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H9Cl2NO5S2/c21-10-4-12-17(24)9(7-26-18(12)13(22)5-10)3-16-19(25)23(20(29)30-16)11-1-2-14-15(6-11)28-8-27-14/h1-7H,8H2/b16-3- |
| InChIKey | PCMXWDXGEXYGNQ-XFQLMFQHSA-N |
| XLogP | 5.23 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|