C27H19ClN2O3S2 — CID 126351799
(5Z)-3-(1,3-benzodioxol-5-yl)-5-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126351799) has the molecular formula C27H19ClN2O3S2 and a molecular weight of 519.05 g/mol. Its IUPAC name is (5Z)-3-(1,3-benzodioxol-5-yl)-5-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(1,3-benzodioxol-5-yl)-5-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126351799 |
| Molecular Formula | C27H19ClN2O3S2 |
| Molecular Weight | 519.05 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | (5Z)-3-(1,3-benzodioxol-5-yl)-5-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1c(/C=C2\SC(=S)N(c3ccc4c(c3)OCO4)C2=O)c2ccccc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C27H19ClN2O3S2/c1-16-20(19-7-3-5-9-22(19)29(16)14-17-6-2-4-8-21(17)28)13-25-26(31)30(27(34)35-25)18-10-11-23-24(12-18)33-15-32-23/h2-13H,14-15H2,1H3/b25-13- |
| InChIKey | LQWNIBCOQWLPGJ-MXAYSNPKSA-N |
| XLogP | 6.79 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.05 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|