C28H25N3OS2 — CID 126345756
(5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-3-[4-(dimethylamino)phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126345756) has the molecular formula C28H25N3OS2 and a molecular weight of 483.66 g/mol. Its IUPAC name is (5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-3-[4-(dimethylamino)phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-3-[4-(dimethylamino)phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126345756 |
| Molecular Formula | C28H25N3OS2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | (5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-3-[4-(dimethylamino)phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1c(/C=C2\SC(=S)N(c3ccc(N(C)C)cc3)C2=O)c2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C28H25N3OS2/c1-19-24(23-11-7-8-12-25(23)30(19)18-20-9-5-4-6-10-20)17-26-27(32)31(28(33)34-26)22-15-13-21(14-16-22)29(2)3/h4-17H,18H2,1-3H3/b26-17- |
| InChIKey | XFEDUTNBBJBAON-ONUIUJJFSA-N |
| XLogP | 6.47 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|