C27H21N3O2S2 — CID 126184532
N-[(5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 126184532) has the molecular formula C27H21N3O2S2 and a molecular weight of 483.62 g/mol. Its IUPAC name is N-[(5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | N-[(5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 126184532 |
| Molecular Formula | C27H21N3O2S2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | N-[(5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | Cc1c(/C=C2\SC(=S)N(NC(=O)c3ccccc3)C2=O)c2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C27H21N3O2S2/c1-18-22(21-14-8-9-15-23(21)29(18)17-19-10-4-2-5-11-19)16-24-26(32)30(27(33)34-24)28-25(31)20-12-6-3-7-13-20/h2-16H,17H2,1H3,(H,28,31)/b24-16- |
| InChIKey | KCRDWZGJRQFCGE-JLPGSUDCSA-N |
| XLogP | 5.54 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|