C27H20Cl2N4O2S2 — CID 126375716
1-[(5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea (PubChem CID 126375716) has the molecular formula C27H20Cl2N4O2S2 and a molecular weight of 567.52 g/mol. Its IUPAC name is 1-[(5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[(5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 126375716 |
| Molecular Formula | C27H20Cl2N4O2S2 |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 566.04 |
| IUPAC Name | 1-[(5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea |
| SMILES | Cc1c(/C=C2\SC(=S)N(NC(=O)Nc3ccc(Cl)c(Cl)c3)C2=O)c2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C27H20Cl2N4O2S2/c1-16-20(19-9-5-6-10-23(19)32(16)15-17-7-3-2-4-8-17)14-24-25(34)33(27(36)37-24)31-26(35)30-18-11-12-21(28)22(29)13-18/h2-14H,15H2,1H3,(H2,30,31,35)/b24-14- |
| InChIKey | FILXWYYZKWUMGP-OYKKKHCWSA-N |
| XLogP | 7.24 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|