C20H15Cl2N3O6S2 — CID 126373571
2-[2-[(E)-[3-[(3,4-dichlorophenyl)carbamoylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid (PubChem CID 126373571) has the molecular formula C20H15Cl2N3O6S2 and a molecular weight of 528.40 g/mol. Its IUPAC name is 2-[2-[(E)-[3-[(3,4-dichlorophenyl)carbamoylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-[(E)-[3-[(3,4-dichlorophenyl)carbamoylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126373571 |
| Molecular Formula | C20H15Cl2N3O6S2 |
| Molecular Weight | 528.40 g/mol |
| Exact Mass | 526.98 |
| IUPAC Name | 2-[2-[(E)-[3-[(3,4-dichlorophenyl)carbamoylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cccc(/C=C2/SC(=S)N(NC(=O)Nc3ccc(Cl)c(Cl)c3)C2=O)c1OCC(=O)O |
| InChI | InChI=1S/C20H15Cl2N3O6S2/c1-30-14-4-2-3-10(17(14)31-9-16(26)27)7-15-18(28)25(20(32)33-15)24-19(29)23-11-5-6-12(21)13(22)8-11/h2-8H,9H2,1H3,(H,26,27)(H2,23,24,29)/b15-7+ |
| InChIKey | SPSBJFOJXYNETL-VIZOYTHASA-N |
| XLogP | 4.40 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|