C22H19Cl2N3O6S2 — CID 18772861
methyl 2-[4-[(E)-[3-[(3,4-dichlorophenyl)carbamoylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]acetate (PubChem CID 18772861) has the molecular formula C22H19Cl2N3O6S2 and a molecular weight of 556.45 g/mol. Its IUPAC name is methyl 2-[4-[(E)-[3-[(3,4-dichlorophenyl)carbamoylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-[3-[(3,4-dichlorophenyl)carbamoylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 18772861 |
| Molecular Formula | C22H19Cl2N3O6S2 |
| Molecular Weight | 556.45 g/mol |
| Exact Mass | 555.01 |
| IUPAC Name | methyl 2-[4-[(E)-[3-[(3,4-dichlorophenyl)carbamoylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(NC(=O)Nc3ccc(Cl)c(Cl)c3)C2=O)ccc1OCC(=O)OC |
| InChI | InChI=1S/C22H19Cl2N3O6S2/c1-3-32-17-8-12(4-7-16(17)33-11-19(28)31-2)9-18-20(29)27(22(34)35-18)26-21(30)25-13-5-6-14(23)15(24)10-13/h4-10H,3,11H2,1-2H3,(H2,25,26,30)/b18-9+ |
| InChIKey | YYDOMOZSHKHRAV-GIJQJNRQSA-N |
| XLogP | 4.88 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|