C18H12BrCl2N3O3S2 — CID 126372311
1-[(5E)-5-[(3-bromo-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea (PubChem CID 126372311) has the molecular formula C18H12BrCl2N3O3S2 and a molecular weight of 533.26 g/mol. Its IUPAC name is 1-[(5E)-5-[(3-bromo-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[(5E)-5-[(3-bromo-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 126372311 |
| Molecular Formula | C18H12BrCl2N3O3S2 |
| Molecular Weight | 533.26 g/mol |
| Exact Mass | 530.89 |
| IUPAC Name | 1-[(5E)-5-[(3-bromo-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea |
| SMILES | COc1ccc(/C=C2/SC(=S)N(NC(=O)Nc3ccc(Cl)c(Cl)c3)C2=O)cc1Br |
| InChI | InChI=1S/C18H12BrCl2N3O3S2/c1-27-14-5-2-9(6-11(14)19)7-15-16(25)24(18(28)29-15)23-17(26)22-10-3-4-12(20)13(21)8-10/h2-8H,1H3,(H2,22,23,26)/b15-7+ |
| InChIKey | HQKXVYSKXKVLQZ-VIZOYTHASA-N |
| XLogP | 5.70 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.26 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|