C21H18Cl2IN3O4S2 — CID 126378259
1-(3,4-dichlorophenyl)-3-[(5Z)-5-[(3-iodo-5-methoxy-4-propoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea (PubChem CID 126378259) has the molecular formula C21H18Cl2IN3O4S2 and a molecular weight of 638.34 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[(5Z)-5-[(3-iodo-5-methoxy-4-propoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[(5Z)-5-[(3-iodo-5-methoxy-4-propoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea |
|---|---|
| PubChem CID | 126378259 |
| Molecular Formula | C21H18Cl2IN3O4S2 |
| Molecular Weight | 638.34 g/mol |
| Exact Mass | 636.92 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[(5Z)-5-[(3-iodo-5-methoxy-4-propoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea |
| SMILES | CCCOc1c(I)cc(/C=C2\SC(=S)N(NC(=O)Nc3ccc(Cl)c(Cl)c3)C2=O)cc1OC |
| InChI | InChI=1S/C21H18Cl2IN3O4S2/c1-3-6-31-18-15(24)7-11(8-16(18)30-2)9-17-19(28)27(21(32)33-17)26-20(29)25-12-4-5-13(22)14(23)10-12/h4-5,7-10H,3,6H2,1-2H3,(H2,25,26,29)/b17-9- |
| InChIKey | YHBAFMHFUZETOI-MFOYZWKCSA-N |
| XLogP | 6.33 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.34 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|