C20H14BrCl2N3O5S2 — CID 126372688
methyl 2-[2-bromo-4-[(E)-[3-[(3,4-dichlorophenyl)carbamoylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126372688) has the molecular formula C20H14BrCl2N3O5S2 and a molecular weight of 591.29 g/mol. Its IUPAC name is methyl 2-[2-bromo-4-[(E)-[3-[(3,4-dichlorophenyl)carbamoylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-4-[(E)-[3-[(3,4-dichlorophenyl)carbamoylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126372688 |
| Molecular Formula | C20H14BrCl2N3O5S2 |
| Molecular Weight | 591.29 g/mol |
| Exact Mass | 588.89 |
| IUPAC Name | methyl 2-[2-bromo-4-[(E)-[3-[(3,4-dichlorophenyl)carbamoylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=C2/SC(=S)N(NC(=O)Nc3ccc(Cl)c(Cl)c3)C2=O)cc1Br |
| InChI | InChI=1S/C20H14BrCl2N3O5S2/c1-30-17(27)9-31-15-5-2-10(6-12(15)21)7-16-18(28)26(20(32)33-16)25-19(29)24-11-3-4-13(22)14(23)8-11/h2-8H,9H2,1H3,(H2,24,25,29)/b16-7+ |
| InChIKey | LVUTUTKIJFFXFD-FRKPEAEDSA-N |
| XLogP | 5.25 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.29 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|