C17H10BrCl2N3O3S2 — CID 126373054
1-[(5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea (PubChem CID 126373054) has the molecular formula C17H10BrCl2N3O3S2 and a molecular weight of 519.23 g/mol. Its IUPAC name is 1-[(5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[(5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 126373054 |
| Molecular Formula | C17H10BrCl2N3O3S2 |
| Molecular Weight | 519.23 g/mol |
| Exact Mass | 516.87 |
| IUPAC Name | 1-[(5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)NN1C(=O)/C(=C\c2ccc(O)c(Br)c2)SC1=S |
| InChI | InChI=1S/C17H10BrCl2N3O3S2/c18-10-5-8(1-4-13(10)24)6-14-15(25)23(17(27)28-14)22-16(26)21-9-2-3-11(19)12(20)7-9/h1-7,24H,(H2,21,22,26)/b14-6+ |
| InChIKey | UJBOMOOHJPNDTP-MKMNVTDBSA-N |
| XLogP | 5.40 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.23 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|