C21H12Cl2FN3O3S2 — CID 126377281
1-(3,4-dichlorophenyl)-3-[(5Z)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea (PubChem CID 126377281) has the molecular formula C21H12Cl2FN3O3S2 and a molecular weight of 508.38 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[(5Z)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[(5Z)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea |
|---|---|
| PubChem CID | 126377281 |
| Molecular Formula | C21H12Cl2FN3O3S2 |
| Molecular Weight | 508.38 g/mol |
| Exact Mass | 506.97 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[(5Z)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)NN1C(=O)/C(=C/c2ccc(-c3ccc(F)cc3)o2)SC1=S |
| InChI | InChI=1S/C21H12Cl2FN3O3S2/c22-15-7-5-13(9-16(15)23)25-20(29)26-27-19(28)18(32-21(27)31)10-14-6-8-17(30-14)11-1-3-12(24)4-2-11/h1-10H,(H2,25,26,29)/b18-10- |
| InChIKey | ORWYPNCGMORVGI-ZDLGFXPLSA-N |
| XLogP | 6.33 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.38 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|