C22H13Cl2N3O5S2 — CID 18772859
2-[5-[(E)-[3-[(3,4-dichlorophenyl)carbamoylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 18772859) has the molecular formula C22H13Cl2N3O5S2 and a molecular weight of 534.40 g/mol. Its IUPAC name is 2-[5-[(E)-[3-[(3,4-dichlorophenyl)carbamoylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[(E)-[3-[(3,4-dichlorophenyl)carbamoylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 18772859 |
| Molecular Formula | C22H13Cl2N3O5S2 |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 532.97 |
| IUPAC Name | 2-[5-[(E)-[3-[(3,4-dichlorophenyl)carbamoylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)NN1C(=O)/C(=C\c2ccc(-c3ccccc3C(=O)O)o2)SC1=S |
| InChI | InChI=1S/C22H13Cl2N3O5S2/c23-15-7-5-11(9-16(15)24)25-21(31)26-27-19(28)18(34-22(27)33)10-12-6-8-17(32-12)13-3-1-2-4-14(13)20(29)30/h1-10H,(H,29,30)(H2,25,26,31)/b18-10+ |
| InChIKey | CKRHAMDSBHYHFK-VCHYOVAHSA-N |
| XLogP | 5.89 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|