C23H18Cl2N4O2S2 — CID 126377678
1-(3,4-dichlorophenyl)-3-[(5E)-5-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea (PubChem CID 126377678) has the molecular formula C23H18Cl2N4O2S2 and a molecular weight of 517.46 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[(5E)-5-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[(5E)-5-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea |
|---|---|
| PubChem CID | 126377678 |
| Molecular Formula | C23H18Cl2N4O2S2 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[(5E)-5-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea |
| SMILES | Cc1cc(/C=C2/SC(=S)N(NC(=O)Nc3ccc(Cl)c(Cl)c3)C2=O)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C23H18Cl2N4O2S2/c1-13-10-15(14(2)28(13)17-6-4-3-5-7-17)11-20-21(30)29(23(32)33-20)27-22(31)26-16-8-9-18(24)19(25)12-16/h3-12H,1-2H3,(H2,26,27,31)/b20-11+ |
| InChIKey | SPBXPTKBPNXGTQ-RGVLZGJSSA-N |
| XLogP | 6.34 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|