C18H13Cl2N3O3S2 — CID 18772827
1-(3,4-dichlorophenyl)-3-[(5E)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea (PubChem CID 18772827) has the molecular formula C18H13Cl2N3O3S2 and a molecular weight of 454.36 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[(5E)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[(5E)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea |
|---|---|
| PubChem CID | 18772827 |
| Molecular Formula | C18H13Cl2N3O3S2 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 452.98 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[(5E)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea |
| SMILES | COc1ccc(/C=C2/SC(=S)N(NC(=O)Nc3ccc(Cl)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C18H13Cl2N3O3S2/c1-26-12-5-2-10(3-6-12)8-15-16(24)23(18(27)28-15)22-17(25)21-11-4-7-13(19)14(20)9-11/h2-9H,1H3,(H2,21,22,25)/b15-8+ |
| InChIKey | SXULAVWNXBRXAO-OVCLIPMQSA-N |
| XLogP | 4.94 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|