C30H23Cl2N3O4S2 — CID 126375836
1-(3,4-dichlorophenyl)-3-[(5E)-5-[[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea (PubChem CID 126375836) has the molecular formula C30H23Cl2N3O4S2 and a molecular weight of 624.57 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[(5E)-5-[[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[(5E)-5-[[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea |
|---|---|
| PubChem CID | 126375836 |
| Molecular Formula | C30H23Cl2N3O4S2 |
| Molecular Weight | 624.57 g/mol |
| Exact Mass | 623.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[(5E)-5-[[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(NC(=O)Nc3ccc(Cl)c(Cl)c3)C2=O)ccc1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H23Cl2N3O4S2/c1-2-38-26-14-18(8-12-25(26)39-17-19-7-9-20-5-3-4-6-21(20)13-19)15-27-28(36)35(30(40)41-27)34-29(37)33-22-10-11-23(31)24(32)16-22/h3-16H,2,17H2,1H3,(H2,33,34,37)/b27-15+ |
| InChIKey | GATXCTGKAFDRDK-JFLMPSFJSA-N |
| XLogP | 8.06 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.57 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|