C28H18Cl3N3O3S2 — CID 126372696
1-[(5E)-5-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea (PubChem CID 126372696) has the molecular formula C28H18Cl3N3O3S2 and a molecular weight of 614.96 g/mol. Its IUPAC name is 1-[(5E)-5-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[(5E)-5-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 126372696 |
| Molecular Formula | C28H18Cl3N3O3S2 |
| Molecular Weight | 614.96 g/mol |
| Exact Mass | 612.99 |
| IUPAC Name | 1-[(5E)-5-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)NN1C(=O)/C(=C\c2c(OCc3ccc(Cl)cc3)ccc3ccccc23)SC1=S |
| InChI | InChI=1S/C28H18Cl3N3O3S2/c29-18-8-5-16(6-9-18)15-37-24-12-7-17-3-1-2-4-20(17)21(24)14-25-26(35)34(28(38)39-25)33-27(36)32-19-10-11-22(30)23(31)13-19/h1-14H,15H2,(H2,32,33,36)/b25-14+ |
| InChIKey | MCRFGBQCXHVYOG-AFUMVMLFSA-N |
| XLogP | 8.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.96 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|