C30H23ClN2O4S — CID 126281754
2-[(5E)-5-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylphenyl)acetamide (PubChem CID 126281754) has the molecular formula C30H23ClN2O4S and a molecular weight of 543.04 g/mol. Its IUPAC name is 2-[(5E)-5-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126281754 |
| Molecular Formula | C30H23ClN2O4S |
| Molecular Weight | 543.04 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | 2-[(5E)-5-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)S/C(=C/c3c(OCc4ccc(Cl)cc4)ccc4ccccc34)C2=O)c1 |
| InChI | InChI=1S/C30H23ClN2O4S/c1-19-5-4-7-23(15-19)32-28(34)17-33-29(35)27(38-30(33)36)16-25-24-8-3-2-6-21(24)11-14-26(25)37-18-20-9-12-22(31)13-10-20/h2-16H,17-18H2,1H3,(H,32,34)/b27-16+ |
| InChIKey | WBNZHTBRNBSLGW-JVWAILMASA-N |
| XLogP | 7.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.04 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|