C31H26N2O4S — CID 126190389
N-(2,4-dimethylphenyl)-2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126190389) has the molecular formula C31H26N2O4S and a molecular weight of 522.63 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126190389 |
| Molecular Formula | C31H26N2O4S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)S/C(=C/c3c(OCc4ccccc4)ccc4ccccc34)C2=O)c(C)c1 |
| InChI | InChI=1S/C31H26N2O4S/c1-20-12-14-26(21(2)16-20)32-29(34)18-33-30(35)28(38-31(33)36)17-25-24-11-7-6-10-23(24)13-15-27(25)37-19-22-8-4-3-5-9-22/h3-17H,18-19H2,1-2H3,(H,32,34)/b28-17+ |
| InChIKey | WZNALEJWKIMBCQ-OGLMXYFKSA-N |
| XLogP | 6.71 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|