C28H28N2O4S — CID 126376063
2-[(5Z)-2,4-dioxo-5-[(2-propoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 126376063) has the molecular formula C28H28N2O4S and a molecular weight of 488.61 g/mol. Its IUPAC name is 2-[(5Z)-2,4-dioxo-5-[(2-propoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[(5Z)-2,4-dioxo-5-[(2-propoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126376063 |
| Molecular Formula | C28H28N2O4S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 2-[(5Z)-2,4-dioxo-5-[(2-propoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CCCOc1ccc2ccccc2c1/C=C1\SC(=O)N(CC(=O)Nc2c(C)cc(C)cc2C)C1=O |
| InChI | InChI=1S/C28H28N2O4S/c1-5-12-34-23-11-10-20-8-6-7-9-21(20)22(23)15-24-27(32)30(28(33)35-24)16-25(31)29-26-18(3)13-17(2)14-19(26)4/h6-11,13-15H,5,12,16H2,1-4H3,(H,29,31)/b24-15- |
| InChIKey | CKONCTXCYQMTGB-IWIPYMOSSA-N |
| XLogP | 6.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|