C28H22N2O3S — CID 126364149
2-[(5E)-5-(anthracen-9-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,5-dimethylphenyl)acetamide (PubChem CID 126364149) has the molecular formula C28H22N2O3S and a molecular weight of 466.56 g/mol. Its IUPAC name is 2-[(5E)-5-(anthracen-9-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-(anthracen-9-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126364149 |
| Molecular Formula | C28H22N2O3S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-[(5E)-5-(anthracen-9-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,5-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)CN2C(=O)S/C(=C/c3c4ccccc4cc4ccccc34)C2=O)c1 |
| InChI | InChI=1S/C28H22N2O3S/c1-17-11-12-18(2)24(13-17)29-26(31)16-30-27(32)25(34-28(30)33)15-23-21-9-5-3-7-19(21)14-20-8-4-6-10-22(20)23/h3-15H,16H2,1-2H3,(H,29,31)/b25-15+ |
| InChIKey | MSAOPXWMXLEIHK-MFKUBSTISA-N |
| XLogP | 6.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|