C23H24N2O5S — CID 126355133
N-(2,5-dimethylphenyl)-2-[(5E)-5-[(2-ethoxy-3-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126355133) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[(5E)-5-[(2-ethoxy-3-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[(5E)-5-[(2-ethoxy-3-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126355133 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[(5E)-5-[(2-ethoxy-3-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CCOc1c(/C=C2/SC(=O)N(CC(=O)Nc3cc(C)ccc3C)C2=O)cccc1OC |
| InChI | InChI=1S/C23H24N2O5S/c1-5-30-21-16(7-6-8-18(21)29-4)12-19-22(27)25(23(28)31-19)13-20(26)24-17-11-14(2)9-10-15(17)3/h6-12H,5,13H2,1-4H3,(H,24,26)/b19-12+ |
| InChIKey | PVWGLINYSTYTOL-XDHOZWIPSA-N |
| XLogP | 4.39 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|