C22H19ClN2O7S — CID 126361919
2-[2-[(E)-[3-[2-(5-chloro-2-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid (PubChem CID 126361919) has the molecular formula C22H19ClN2O7S and a molecular weight of 490.92 g/mol. Its IUPAC name is 2-[2-[(E)-[3-[2-(5-chloro-2-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-[(E)-[3-[2-(5-chloro-2-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126361919 |
| Molecular Formula | C22H19ClN2O7S |
| Molecular Weight | 490.92 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | 2-[2-[(E)-[3-[2-(5-chloro-2-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cccc(/C=C2/SC(=O)N(CC(=O)Nc3cc(Cl)ccc3C)C2=O)c1OCC(=O)O |
| InChI | InChI=1S/C22H19ClN2O7S/c1-12-6-7-14(23)9-15(12)24-18(26)10-25-21(29)17(33-22(25)30)8-13-4-3-5-16(31-2)20(13)32-11-19(27)28/h3-9H,10-11H2,1-2H3,(H,24,26)(H,27,28)/b17-8+ |
| InChIKey | GTBLLGLSWBBNSG-CAOOACKPSA-N |
| XLogP | 3.80 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.92 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|