C18H15IN2O4S — CID 126355165
N-(2,5-dimethylphenyl)-2-[(5Z)-5-[(5-iodofuran-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126355165) has the molecular formula C18H15IN2O4S and a molecular weight of 482.30 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[(5Z)-5-[(5-iodofuran-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[(5Z)-5-[(5-iodofuran-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126355165 |
| Molecular Formula | C18H15IN2O4S |
| Molecular Weight | 482.30 g/mol |
| Exact Mass | 481.98 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[(5Z)-5-[(5-iodofuran-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)CN2C(=O)S/C(=C\c3ccc(I)o3)C2=O)c1 |
| InChI | InChI=1S/C18H15IN2O4S/c1-10-3-4-11(2)13(7-10)20-16(22)9-21-17(23)14(26-18(21)24)8-12-5-6-15(19)25-12/h3-8H,9H2,1-2H3,(H,20,22)/b14-8- |
| InChIKey | QHVORUSXJUHPDN-ZSOIEALJSA-N |
| XLogP | 4.18 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|