C29H21BrN2O4S — CID 126348892
N-(2-bromophenyl)-2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126348892) has the molecular formula C29H21BrN2O4S and a molecular weight of 573.47 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126348892 |
| Molecular Formula | C29H21BrN2O4S |
| Molecular Weight | 573.47 g/mol |
| Exact Mass | 572.04 |
| IUPAC Name | N-(2-bromophenyl)-2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2c(OCc3ccccc3)ccc3ccccc23)C1=O)Nc1ccccc1Br |
| InChI | InChI=1S/C29H21BrN2O4S/c30-23-12-6-7-13-24(23)31-27(33)17-32-28(34)26(37-29(32)35)16-22-21-11-5-4-10-20(21)14-15-25(22)36-18-19-8-2-1-3-9-19/h1-16H,17-18H2,(H,31,33)/b26-16+ |
| InChIKey | FDGYGJBVLKNRDK-WGOQTCKBSA-N |
| XLogP | 6.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.47 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|