C34H29ClN2O6S — CID 126169387
butyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126169387) has the molecular formula C34H29ClN2O6S and a molecular weight of 629.13 g/mol. Its IUPAC name is butyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | butyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126169387 |
| Molecular Formula | C34H29ClN2O6S |
| Molecular Weight | 629.13 g/mol |
| Exact Mass | 628.14 |
| IUPAC Name | butyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3c(OCc4ccccc4)ccc4ccccc34)C2=O)ccc1Cl |
| InChI | InChI=1S/C34H29ClN2O6S/c1-2-3-17-42-33(40)27-18-24(14-15-28(27)35)36-31(38)20-37-32(39)30(44-34(37)41)19-26-25-12-8-7-11-23(25)13-16-29(26)43-21-22-9-5-4-6-10-22/h4-16,18-19H,2-3,17,20-21H2,1H3,(H,36,38)/b30-19+ |
| InChIKey | LWGXVOHGKMQYLB-NDZAJKAJSA-N |
| XLogP | 7.70 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.13 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|