C30H25BrCl2N2O6S — CID 126161419
butyl 5-[[2-[(5E)-5-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate (PubChem CID 126161419) has the molecular formula C30H25BrCl2N2O6S and a molecular weight of 692.42 g/mol. Its IUPAC name is butyl 5-[[2-[(5E)-5-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate.
| Compound Name | butyl 5-[[2-[(5E)-5-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 126161419 |
| Molecular Formula | C30H25BrCl2N2O6S |
| Molecular Weight | 692.42 g/mol |
| Exact Mass | 690.00 |
| IUPAC Name | butyl 5-[[2-[(5E)-5-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate |
| SMILES | CCCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3cc(Br)ccc3OCc3ccccc3Cl)C2=O)ccc1Cl |
| InChI | InChI=1S/C30H25BrCl2N2O6S/c1-2-3-12-40-29(38)22-15-21(9-10-24(22)33)34-27(36)16-35-28(37)26(42-30(35)39)14-19-13-20(31)8-11-25(19)41-17-18-6-4-5-7-23(18)32/h4-11,13-15H,2-3,12,16-17H2,1H3,(H,34,36)/b26-14+ |
| InChIKey | CBHVFIWXAJBUJV-VULFUBBASA-N |
| XLogP | 7.97 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.42 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|