C27H29ClN2O6S — CID 126163312
butyl 5-[[2-[(5Z)-5-[(4-butoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate (PubChem CID 126163312) has the molecular formula C27H29ClN2O6S and a molecular weight of 545.06 g/mol. Its IUPAC name is butyl 5-[[2-[(5Z)-5-[(4-butoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate.
| Compound Name | butyl 5-[[2-[(5Z)-5-[(4-butoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 126163312 |
| Molecular Formula | C27H29ClN2O6S |
| Molecular Weight | 545.06 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | butyl 5-[[2-[(5Z)-5-[(4-butoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate |
| SMILES | CCCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3ccc(OCCCC)cc3)C2=O)ccc1Cl |
| InChI | InChI=1S/C27H29ClN2O6S/c1-3-5-13-35-20-10-7-18(8-11-20)15-23-25(32)30(27(34)37-23)17-24(31)29-19-9-12-22(28)21(16-19)26(33)36-14-6-4-2/h7-12,15-16H,3-6,13-14,17H2,1-2H3,(H,29,31)/b23-15- |
| InChIKey | UNBKFXAQUUKBSN-HAHDFKILSA-N |
| XLogP | 6.15 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.06 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|