C30H26ClN3O8S — CID 126176139
butyl 2-chloro-5-[[2-[(5E)-5-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126176139) has the molecular formula C30H26ClN3O8S and a molecular weight of 624.07 g/mol. Its IUPAC name is butyl 2-chloro-5-[[2-[(5E)-5-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | butyl 2-chloro-5-[[2-[(5E)-5-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126176139 |
| Molecular Formula | C30H26ClN3O8S |
| Molecular Weight | 624.07 g/mol |
| Exact Mass | 623.11 |
| IUPAC Name | butyl 2-chloro-5-[[2-[(5E)-5-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(OCc4ccc([N+](=O)[O-])cc4)cc3)C2=O)ccc1Cl |
| InChI | InChI=1S/C30H26ClN3O8S/c1-2-3-14-41-29(37)24-16-21(8-13-25(24)31)32-27(35)17-33-28(36)26(43-30(33)38)15-19-6-11-23(12-7-19)42-18-20-4-9-22(10-5-20)34(39)40/h4-13,15-16H,2-3,14,17-18H2,1H3,(H,32,35)/b26-15+ |
| InChIKey | RKUKMBXJCHWXJI-CVKSISIWSA-N |
| XLogP | 6.46 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.07 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|