C27H21ClN4O8S — CID 126202510
propyl 2-chloro-5-[[2-[(5Z)-5-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126202510) has the molecular formula C27H21ClN4O8S and a molecular weight of 597.01 g/mol. Its IUPAC name is propyl 2-chloro-5-[[2-[(5Z)-5-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | propyl 2-chloro-5-[[2-[(5Z)-5-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126202510 |
| Molecular Formula | C27H21ClN4O8S |
| Molecular Weight | 597.01 g/mol |
| Exact Mass | 596.08 |
| IUPAC Name | propyl 2-chloro-5-[[2-[(5Z)-5-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3ccc(Oc4ccc([N+](=O)[O-])cn4)cc3)C2=O)ccc1Cl |
| InChI | InChI=1S/C27H21ClN4O8S/c1-2-11-39-26(35)20-13-17(5-9-21(20)28)30-23(33)15-31-25(34)22(41-27(31)36)12-16-3-7-19(8-4-16)40-24-10-6-18(14-29-24)32(37)38/h3-10,12-14H,2,11,15H2,1H3,(H,30,33)/b22-12- |
| InChIKey | VIBBNGYSPDNHMT-UUYOSTAYSA-N |
| XLogP | 5.68 |
| TPSA | 158.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.01 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|