C23H15ClN4O6S — CID 126213989
N-(3-chlorophenyl)-2-[(5Z)-5-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126213989) has the molecular formula C23H15ClN4O6S and a molecular weight of 510.92 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[(5Z)-5-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[(5Z)-5-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126213989 |
| Molecular Formula | C23H15ClN4O6S |
| Molecular Weight | 510.92 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | N-(3-chlorophenyl)-2-[(5Z)-5-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(Oc3ccc([N+](=O)[O-])cn3)cc2)C1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H15ClN4O6S/c24-15-2-1-3-16(11-15)26-20(29)13-27-22(30)19(35-23(27)31)10-14-4-7-18(8-5-14)34-21-9-6-17(12-25-21)28(32)33/h1-12H,13H2,(H,26,29)/b19-10- |
| InChIKey | ZTRBCYMERMIGII-GRSHGNNSSA-N |
| XLogP | 5.11 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.92 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|