C27H23N5O6S — CID 22305068
(5Z)-5-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 22305068) has the molecular formula C27H23N5O6S and a molecular weight of 545.58 g/mol. Its IUPAC name is (5Z)-5-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 22305068 |
| Molecular Formula | C27H23N5O6S |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | (5Z)-5-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(Oc3ccc([N+](=O)[O-])cn3)cc2)C1=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H23N5O6S/c33-25(30-14-12-29(13-15-30)20-4-2-1-3-5-20)18-31-26(34)23(39-27(31)35)16-19-6-9-22(10-7-19)38-24-11-8-21(17-28-24)32(36)37/h1-11,16-17H,12-15,18H2/b23-16- |
| InChIKey | VPELDWBJKDEKTA-KQWNVCNZSA-N |
| XLogP | 4.17 |
| TPSA | 126.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|