C27H27ClN2O8S — CID 126161849
butyl 2-chloro-5-[[2-[(5Z)-5-[[4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126161849) has the molecular formula C27H27ClN2O8S and a molecular weight of 575.04 g/mol. Its IUPAC name is butyl 2-chloro-5-[[2-[(5Z)-5-[[4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | butyl 2-chloro-5-[[2-[(5Z)-5-[[4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126161849 |
| Molecular Formula | C27H27ClN2O8S |
| Molecular Weight | 575.04 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | butyl 2-chloro-5-[[2-[(5Z)-5-[[4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3ccc(OCC(=O)OCC)cc3)C2=O)ccc1Cl |
| InChI | InChI=1S/C27H27ClN2O8S/c1-3-5-12-37-26(34)20-14-18(8-11-21(20)28)29-23(31)15-30-25(33)22(39-27(30)35)13-17-6-9-19(10-7-17)38-16-24(32)36-4-2/h6-11,13-14H,3-5,12,15-16H2,1-2H3,(H,29,31)/b22-13- |
| InChIKey | QGWSJGQEWRKGIP-XKZIYDEJSA-N |
| XLogP | 4.91 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.04 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|