C23H19ClI2N2O6S — CID 126168553
butyl 2-chloro-5-[[2-[(5E)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126168553) has the molecular formula C23H19ClI2N2O6S and a molecular weight of 740.74 g/mol. Its IUPAC name is butyl 2-chloro-5-[[2-[(5E)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | butyl 2-chloro-5-[[2-[(5E)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126168553 |
| Molecular Formula | C23H19ClI2N2O6S |
| Molecular Weight | 740.74 g/mol |
| Exact Mass | 739.87 |
| IUPAC Name | butyl 2-chloro-5-[[2-[(5E)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3cc(I)c(O)c(I)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C23H19ClI2N2O6S/c1-2-3-6-34-22(32)14-10-13(4-5-15(14)24)27-19(29)11-28-21(31)18(35-23(28)33)9-12-7-16(25)20(30)17(26)8-12/h4-5,7-10,30H,2-3,6,11H2,1H3,(H,27,29)/b18-9+ |
| InChIKey | ZGLLEMXBCBJCST-GIJQJNRQSA-N |
| XLogP | 5.89 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.74 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|