C26H26ClIN2O7S — CID 126169628
propyl 2-chloro-5-[[2-[(5E)-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126169628) has the molecular formula C26H26ClIN2O7S and a molecular weight of 672.92 g/mol. Its IUPAC name is propyl 2-chloro-5-[[2-[(5E)-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | propyl 2-chloro-5-[[2-[(5E)-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126169628 |
| Molecular Formula | C26H26ClIN2O7S |
| Molecular Weight | 672.92 g/mol |
| Exact Mass | 672.02 |
| IUPAC Name | propyl 2-chloro-5-[[2-[(5E)-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3cc(I)c(OCC)c(OCC)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C26H26ClIN2O7S/c1-4-9-37-25(33)17-13-16(7-8-18(17)27)29-22(31)14-30-24(32)21(38-26(30)34)12-15-10-19(28)23(36-6-3)20(11-15)35-5-2/h7-8,10-13H,4-6,9,14H2,1-3H3,(H,29,31)/b21-12+ |
| InChIKey | QEGIYFMQMHRFCV-CIAFOILYSA-N |
| XLogP | 5.98 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.92 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|