C23H20ClIN2O7S — CID 126171024
methyl 2-chloro-5-[[2-[(5E)-5-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126171024) has the molecular formula C23H20ClIN2O7S and a molecular weight of 630.84 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-[(5E)-5-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-[(5E)-5-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126171024 |
| Molecular Formula | C23H20ClIN2O7S |
| Molecular Weight | 630.84 g/mol |
| Exact Mass | 629.97 |
| IUPAC Name | methyl 2-chloro-5-[[2-[(5E)-5-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCOc1c(I)cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(Cl)c(C(=O)OC)c3)C2=O)cc1OC |
| InChI | InChI=1S/C23H20ClIN2O7S/c1-4-34-20-16(25)7-12(8-17(20)32-2)9-18-21(29)27(23(31)35-18)11-19(28)26-13-5-6-15(24)14(10-13)22(30)33-3/h5-10H,4,11H2,1-3H3,(H,26,28)/b18-9+ |
| InChIKey | NFDOGFXAIPXCEE-GIJQJNRQSA-N |
| XLogP | 4.81 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.84 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|