C24H20ClIN2O9S — CID 126162076
methyl 2-chloro-5-[[2-[(5Z)-5-[[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126162076) has the molecular formula C24H20ClIN2O9S and a molecular weight of 674.85 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-[(5Z)-5-[[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-[(5Z)-5-[[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126162076 |
| Molecular Formula | C24H20ClIN2O9S |
| Molecular Weight | 674.85 g/mol |
| Exact Mass | 673.96 |
| IUPAC Name | methyl 2-chloro-5-[[2-[(5Z)-5-[[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)COc1c(I)cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(Cl)c(C(=O)OC)c3)C2=O)cc1OC |
| InChI | InChI=1S/C24H20ClIN2O9S/c1-34-17-7-12(6-16(26)21(17)37-11-20(30)35-2)8-18-22(31)28(24(33)38-18)10-19(29)27-13-4-5-15(25)14(9-13)23(32)36-3/h4-9H,10-11H2,1-3H3,(H,27,29)/b18-8- |
| InChIKey | CSAYECKLASROHH-LSCVHKIXSA-N |
| XLogP | 3.97 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.85 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|