C26H24ClIN2O9S — CID 126157965
propyl 2-chloro-5-[[2-[(5Z)-5-[[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126157965) has the molecular formula C26H24ClIN2O9S and a molecular weight of 702.91 g/mol. Its IUPAC name is propyl 2-chloro-5-[[2-[(5Z)-5-[[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | propyl 2-chloro-5-[[2-[(5Z)-5-[[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126157965 |
| Molecular Formula | C26H24ClIN2O9S |
| Molecular Weight | 702.91 g/mol |
| Exact Mass | 701.99 |
| IUPAC Name | propyl 2-chloro-5-[[2-[(5Z)-5-[[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3cc(I)c(OCC(=O)OC)c(OC)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C26H24ClIN2O9S/c1-4-7-38-25(34)16-11-15(5-6-17(16)27)29-21(31)12-30-24(33)20(40-26(30)35)10-14-8-18(28)23(19(9-14)36-2)39-13-22(32)37-3/h5-6,8-11H,4,7,12-13H2,1-3H3,(H,29,31)/b20-10- |
| InChIKey | BVTVKJFWYYENKT-JMIUGGIZSA-N |
| XLogP | 4.75 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|