C30H27ClN2O7S — CID 126165700
propyl 2-chloro-5-[[2-[(5E)-5-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126165700) has the molecular formula C30H27ClN2O7S and a molecular weight of 595.07 g/mol. Its IUPAC name is propyl 2-chloro-5-[[2-[(5E)-5-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | propyl 2-chloro-5-[[2-[(5E)-5-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126165700 |
| Molecular Formula | C30H27ClN2O7S |
| Molecular Weight | 595.07 g/mol |
| Exact Mass | 594.12 |
| IUPAC Name | propyl 2-chloro-5-[[2-[(5E)-5-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(OCc4ccccc4)c(OC)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C30H27ClN2O7S/c1-3-13-39-29(36)22-16-21(10-11-23(22)31)32-27(34)17-33-28(35)26(41-30(33)37)15-20-9-12-24(25(14-20)38-2)40-18-19-7-5-4-6-8-19/h4-12,14-16H,3,13,17-18H2,1-2H3,(H,32,34)/b26-15+ |
| InChIKey | ZYKAWQCIJPJSOC-CVKSISIWSA-N |
| XLogP | 6.17 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.07 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|