C26H25ClN2O9S — CID 126174215
2-[4-[(E)-[3-[2-(3-butoxycarbonyl-4-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid (PubChem CID 126174215) has the molecular formula C26H25ClN2O9S and a molecular weight of 577.01 g/mol. Its IUPAC name is 2-[4-[(E)-[3-[2-(3-butoxycarbonyl-4-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-[3-[2-(3-butoxycarbonyl-4-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126174215 |
| Molecular Formula | C26H25ClN2O9S |
| Molecular Weight | 577.01 g/mol |
| Exact Mass | 576.10 |
| IUPAC Name | 2-[4-[(E)-[3-[2-(3-butoxycarbonyl-4-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid |
| SMILES | CCCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(OCC(=O)O)c(OC)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C26H25ClN2O9S/c1-3-4-9-37-25(34)17-12-16(6-7-18(17)27)28-22(30)13-29-24(33)21(39-26(29)35)11-15-5-8-19(20(10-15)36-2)38-14-23(31)32/h5-8,10-12H,3-4,9,13-14H2,1-2H3,(H,28,30)(H,31,32)/b21-11+ |
| InChIKey | KKZIZQICRMJXRI-SRZZPIQSSA-N |
| XLogP | 4.44 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.01 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|