C30H24ClN3O7S — CID 126166946
ethyl 2-chloro-5-[[2-[(5Z)-5-[[4-[(2-cyanophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126166946) has the molecular formula C30H24ClN3O7S and a molecular weight of 606.06 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-[(5Z)-5-[[4-[(2-cyanophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[2-[(5Z)-5-[[4-[(2-cyanophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126166946 |
| Molecular Formula | C30H24ClN3O7S |
| Molecular Weight | 606.06 g/mol |
| Exact Mass | 605.10 |
| IUPAC Name | ethyl 2-chloro-5-[[2-[(5Z)-5-[[4-[(2-cyanophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3ccc(OCc4ccccc4C#N)c(OC)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C30H24ClN3O7S/c1-3-40-29(37)22-14-21(9-10-23(22)31)33-27(35)16-34-28(36)26(42-30(34)38)13-18-8-11-24(25(12-18)39-2)41-17-20-7-5-4-6-19(20)15-32/h4-14H,3,16-17H2,1-2H3,(H,33,35)/b26-13- |
| InChIKey | VPWGQCPPQRSQCI-ZMFRSBBQSA-N |
| XLogP | 5.65 |
| TPSA | 135.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.06 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|