C29H24ClN3O9S — CID 126157312
methyl 2-chloro-5-[[2-[(5E)-5-[[3-ethoxy-4-[(2-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126157312) has the molecular formula C29H24ClN3O9S and a molecular weight of 626.04 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-[(5E)-5-[[3-ethoxy-4-[(2-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-[(5E)-5-[[3-ethoxy-4-[(2-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126157312 |
| Molecular Formula | C29H24ClN3O9S |
| Molecular Weight | 626.04 g/mol |
| Exact Mass | 625.09 |
| IUPAC Name | methyl 2-chloro-5-[[2-[(5E)-5-[[3-ethoxy-4-[(2-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(Cl)c(C(=O)OC)c3)C2=O)ccc1OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H24ClN3O9S/c1-3-41-24-12-17(8-11-23(24)42-16-18-6-4-5-7-22(18)33(38)39)13-25-27(35)32(29(37)43-25)15-26(34)31-19-9-10-21(30)20(14-19)28(36)40-2/h4-14H,3,15-16H2,1-2H3,(H,31,34)/b25-13+ |
| InChIKey | FTWTWSRWFLSZQC-DHRITJCHSA-N |
| XLogP | 5.69 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.04 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|